C12H23N2O2+ — CID 175124173
5-(3-methylimidazol-3-ium-1-yl)octane-2,6-diol (PubChem CID 175124173) has the molecular formula C12H23N2O2+ and a molecular weight of 227.33 g/mol. Its IUPAC name is 5-(3-methylimidazol-3-ium-1-yl)octane-2,6-diol.
| Compound Name | 5-(3-methylimidazol-3-ium-1-yl)octane-2,6-diol |
|---|---|
| PubChem CID | 175124173 |
| Molecular Formula | C12H23N2O2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | 5-(3-methylimidazol-3-ium-1-yl)octane-2,6-diol |
| SMILES | CCC(O)C(CCC(C)O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C12H23N2O2/c1-4-12(16)11(6-5-10(2)15)14-8-7-13(3)9-14/h7-12,15-16H,4-6H2,1-3H3/q+1 |
| InChIKey | IYEPQFWYQVTFTO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|