C19H20N2O6 — CID 161030471
5-isocyanato-1-(5-isocyanato-2,3-dimethoxyphenyl)-2,3-dimethoxybenzene;methane (PubChem CID 161030471) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 5-isocyanato-1-(5-isocyanato-2,3-dimethoxyphenyl)-2,3-dimethoxybenzene;methane.
| Compound Name | 5-isocyanato-1-(5-isocyanato-2,3-dimethoxyphenyl)-2,3-dimethoxybenzene;methane |
|---|---|
| PubChem CID | 161030471 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-isocyanato-1-(5-isocyanato-2,3-dimethoxyphenyl)-2,3-dimethoxybenzene;methane |
| SMILES | C.COc1cc(N=C=O)cc(-c2cc(N=C=O)cc(OC)c2OC)c1OC |
| InChI | InChI=1S/C18H16N2O6.CH4/c1-23-15-7-11(19-9-21)5-13(17(15)25-3)14-6-12(20-10-22)8-16(24-2)18(14)26-4;/h5-8H,1-4H3;1H4 |
| InChIKey | TZNXIGXEMKJMEQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|