C8H5Br2NO2 — CID 103416882
1,5-dibromo-2-isocyanato-4-methoxybenzene (PubChem CID 103416882) has the molecular formula C8H5Br2NO2 and a molecular weight of 306.94 g/mol. Its IUPAC name is 1,5-dibromo-2-isocyanato-4-methoxybenzene.
| Compound Name | 1,5-dibromo-2-isocyanato-4-methoxybenzene |
|---|---|
| PubChem CID | 103416882 |
| Molecular Formula | C8H5Br2NO2 |
| Molecular Weight | 306.94 g/mol |
| Exact Mass | 304.87 |
| IUPAC Name | 1,5-dibromo-2-isocyanato-4-methoxybenzene |
| SMILES | COc1cc(N=C=O)c(Br)cc1Br |
| InChI | InChI=1S/C8H5Br2NO2/c1-13-8-3-7(11-4-12)5(9)2-6(8)10/h2-3H,1H3 |
| InChIKey | JBUPWJIBEYSCKO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.94 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|