C9H7BrFNO3 — CID 169355771
1-bromo-3-fluoro-5-isocyanato-2,4-dimethoxybenzene (PubChem CID 169355771) has the molecular formula C9H7BrFNO3 and a molecular weight of 276.06 g/mol. Its IUPAC name is 1-bromo-3-fluoro-5-isocyanato-2,4-dimethoxybenzene.
| Compound Name | 1-bromo-3-fluoro-5-isocyanato-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 169355771 |
| Molecular Formula | C9H7BrFNO3 |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 1-bromo-3-fluoro-5-isocyanato-2,4-dimethoxybenzene |
| SMILES | COc1c(Br)cc(N=C=O)c(OC)c1F |
| InChI | InChI=1S/C9H7BrFNO3/c1-14-8-5(10)3-6(12-4-13)9(15-2)7(8)11/h3H,1-2H3 |
| InChIKey | WFCDNNOMTDYUQR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|