About but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one
but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one (PubChem CID 161033234) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one.
Molecular Properties
| Compound Name | but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one |
| PubChem CID | 161033234 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(C)=O.C=CC(C)=O.CCC1CO1 |
| InChI | InChI=1S/C5H8O.C4H8O.C4H6O/c1-4(2)5(3)6;1-2-4-3-5-4;1-3-4(2)5/h1H2,2-3H3;4H,2-3H2,1H3;3H,1H2,2H3 |
| InChIKey | TZXDPNZUEGZEOP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one?
The IUPAC name of but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one (CID 161033234) is but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one.
What is the SMILES notation for but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one?
The canonical SMILES for but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one is C=C(C)C(C)=O.C=CC(C)=O.CCC1CO1.
What is the InChIKey of but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one?
The InChIKey is TZXDPNZUEGZEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O.C4H8O.C4H6O/c1-4(2)5(3)6;1-2-4-3-5-4;1-3-4(2)5/h1H2,2-3H3;4H,2-3H2,1H3;3H,1H2,2H3.
What are the key properties of but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one?
but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one has a molecular weight of 226.32 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;2-ethyloxirane;3-methylbut-3-en-2-one is sourced from PubChem (CID 161033234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).