C13H27F2NO2 — CID 161036346
N-tert-butyl-3,3-difluoro-4-(2-propoxyethoxy)butan-1-amine (PubChem CID 161036346) has the molecular formula C13H27F2NO2 and a molecular weight of 267.36 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoro-4-(2-propoxyethoxy)butan-1-amine.
| Compound Name | N-tert-butyl-3,3-difluoro-4-(2-propoxyethoxy)butan-1-amine |
|---|---|
| PubChem CID | 161036346 |
| Molecular Formula | C13H27F2NO2 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-tert-butyl-3,3-difluoro-4-(2-propoxyethoxy)butan-1-amine |
| SMILES | CCCOCCOCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C13H27F2NO2/c1-5-8-17-9-10-18-11-13(14,15)6-7-16-12(2,3)4/h16H,5-11H2,1-4H3 |
| InChIKey | BEWJTZZVZBOBOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|