C42H48BBrO10 — CID 161038182
ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromo-3-methylbenzoate;methyl 4-(2-ethoxycarbonylphenyl)-3-methylbenzoate (PubChem CID 161038182) has the molecular formula C42H48BBrO10 and a molecular weight of 803.55 g/mol. Its IUPAC name is ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromo-3-methylbenzoate;methyl 4-(2-ethoxycarbonylphenyl)-3-methylbenzoate.
| Compound Name | ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromo-3-methylbenzoate;methyl 4-(2-ethoxycarbonylphenyl)-3-methylbenzoate |
|---|---|
| PubChem CID | 161038182 |
| Molecular Formula | C42H48BBrO10 |
| Molecular Weight | 803.55 g/mol |
| Exact Mass | 802.25 |
| IUPAC Name | ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;methyl 4-bromo-3-methylbenzoate;methyl 4-(2-ethoxycarbonylphenyl)-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccccc1-c1ccc(C(=O)OC)cc1C.CCOC(=O)c1ccccc1B1OC(C)(C)C(C)(C)O1.COC(=O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C18H18O4.C15H21BO4.C9H9BrO2/c1-4-22-18(20)16-8-6-5-7-15(16)14-10-9-13(11-12(14)2)17(19)21-3;1-6-18-13(17)11-9-7-8-10-12(11)16-19-14(2,3)15(4,5)20-16;1-6-5-7(9(11)12-2)3-4-8(6)10/h5-11H,4H2,1-3H3;7-10H,6H2,1-5H3;3-5H,1-2H3 |
| InChIKey | UANKQFZSALFQLX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.55 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|