C12H10ClN3OS2 — CID 161039366
2-(3-chlorophenoxy)-1,3,5-triazine;1,3-dithiole (PubChem CID 161039366) has the molecular formula C12H10ClN3OS2 and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1,3,5-triazine;1,3-dithiole.
| Compound Name | 2-(3-chlorophenoxy)-1,3,5-triazine;1,3-dithiole |
|---|---|
| PubChem CID | 161039366 |
| Molecular Formula | C12H10ClN3OS2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-(3-chlorophenoxy)-1,3,5-triazine;1,3-dithiole |
| SMILES | C1=CSCS1.Clc1cccc(Oc2ncncn2)c1 |
| InChI | InChI=1S/C9H6ClN3O.C3H4S2/c10-7-2-1-3-8(4-7)14-9-12-5-11-6-13-9;1-2-5-3-4-1/h1-6H;1-2H,3H2 |
| InChIKey | UARJKDJHVQYFLW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |