C20H24ClN5O2S — CID 161042557
(3-chloro-5-methylphenyl)methyl 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (PubChem CID 161042557) has the molecular formula C20H24ClN5O2S and a molecular weight of 433.97 g/mol. Its IUPAC name is (3-chloro-5-methylphenyl)methyl 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate.
| Compound Name | (3-chloro-5-methylphenyl)methyl 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
|---|---|
| PubChem CID | 161042557 |
| Molecular Formula | C20H24ClN5O2S |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (3-chloro-5-methylphenyl)methyl 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| SMILES | Cc1cc(Cl)cc(COC(=O)N2CCCn3nc(CNC4=NCCS4)cc3C2)c1 |
| InChI | InChI=1S/C20H24ClN5O2S/c1-14-7-15(9-16(21)8-14)13-28-20(27)25-4-2-5-26-18(12-25)10-17(24-26)11-23-19-22-3-6-29-19/h7-10H,2-6,11-13H2,1H3,(H,22,23) |
| InChIKey | UBBLCTMNJVDNAF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |