About CID 161043845
CID 161043845 (PubChem CID 161043845) has the molecular formula C15H20B3N2O
and a molecular weight of 276.77 g/mol.
Molecular Properties
| Compound Name | CID 161043845 |
| PubChem CID | 161043845 |
| Molecular Formula | C15H20B3N2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | — |
| SMILES | Cn1ccc2ccc(OCCN3CCCC3)cc21.[B][B][B] |
| InChI | InChI=1S/C15H20N2O.B3/c1-16-9-6-13-4-5-14(12-15(13)16)18-11-10-17-7-2-3-8-17;1-3-2/h4-6,9,12H,2-3,7-8,10-11H2,1H3; |
| InChIKey | VYLWEXXZWHFFGK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161043845 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161043845?
The IUPAC name of CID 161043845 (CID 161043845) is not available.
What is the SMILES notation for CID 161043845?
The canonical SMILES for CID 161043845 is Cn1ccc2ccc(OCCN3CCCC3)cc21.[B][B][B].
What is the InChIKey of CID 161043845?
The InChIKey is VYLWEXXZWHFFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O.B3/c1-16-9-6-13-4-5-14(12-15(13)16)18-11-10-17-7-2-3-8-17;1-3-2/h4-6,9,12H,2-3,7-8,10-11H2,1H3;.
What are the key properties of CID 161043845?
CID 161043845 has a molecular weight of 276.77 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161043845 is sourced from PubChem (CID 161043845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).