C18H17F2NO4 — CID 161047261
3-(3-fluorophenoxy)propanenitrile;3-(3-fluorophenoxy)propanoic acid (PubChem CID 161047261) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is 3-(3-fluorophenoxy)propanenitrile;3-(3-fluorophenoxy)propanoic acid.
| Compound Name | 3-(3-fluorophenoxy)propanenitrile;3-(3-fluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 161047261 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-(3-fluorophenoxy)propanenitrile;3-(3-fluorophenoxy)propanoic acid |
| SMILES | N#CCCOc1cccc(F)c1.O=C(O)CCOc1cccc(F)c1 |
| InChI | InChI=1S/C9H8FNO.C9H9FO3/c10-8-3-1-4-9(7-8)12-6-2-5-11;10-7-2-1-3-8(6-7)13-5-4-9(11)12/h1,3-4,7H,2,6H2;1-3,6H,4-5H2,(H,11,12) |
| InChIKey | UBQUAYOKGYXACW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|