C11H12FNO5 — CID 63930757
2-[3-(3-fluorophenoxy)propanoylamino]oxyacetic acid (PubChem CID 63930757) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-[3-(3-fluorophenoxy)propanoylamino]oxyacetic acid.
| Compound Name | 2-[3-(3-fluorophenoxy)propanoylamino]oxyacetic acid |
|---|---|
| PubChem CID | 63930757 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[3-(3-fluorophenoxy)propanoylamino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)CCOc1cccc(F)c1 |
| InChI | InChI=1S/C11H12FNO5/c12-8-2-1-3-9(6-8)17-5-4-10(14)13-18-7-11(15)16/h1-3,6H,4-5,7H2,(H,13,14)(H,15,16) |
| InChIKey | UGWWOORUZPYNFU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|