C12H28O3Si2 — CID 161049583
silylsilane;1,1,2-trimethoxynona-1,4-diene (PubChem CID 161049583) has the molecular formula C12H28O3Si2 and a molecular weight of 276.52 g/mol. Its IUPAC name is silylsilane;1,1,2-trimethoxynona-1,4-diene.
| Compound Name | silylsilane;1,1,2-trimethoxynona-1,4-diene |
|---|---|
| PubChem CID | 161049583 |
| Molecular Formula | C12H28O3Si2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | silylsilane;1,1,2-trimethoxynona-1,4-diene |
| SMILES | CCCCC=CCC(OC)=C(OC)OC.[SiH3][SiH3] |
| InChI | InChI=1S/C12H22O3.H6Si2/c1-5-6-7-8-9-10-11(13-2)12(14-3)15-4;1-2/h8-9H,5-7,10H2,1-4H3;1-2H3 |
| InChIKey | UBYLEQJAQHEQSR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|