C29H24ClNO10 — CID 161052521
2-methoxycarbonylbenzoic acid;methyl 2-carbonochloridoylbenzoate;methyl 2-(1,3-oxazol-2-yl)benzoate (PubChem CID 161052521) has the molecular formula C29H24ClNO10 and a molecular weight of 581.96 g/mol. Its IUPAC name is 2-methoxycarbonylbenzoic acid;methyl 2-carbonochloridoylbenzoate;methyl 2-(1,3-oxazol-2-yl)benzoate.
| Compound Name | 2-methoxycarbonylbenzoic acid;methyl 2-carbonochloridoylbenzoate;methyl 2-(1,3-oxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 161052521 |
| Molecular Formula | C29H24ClNO10 |
| Molecular Weight | 581.96 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 2-methoxycarbonylbenzoic acid;methyl 2-carbonochloridoylbenzoate;methyl 2-(1,3-oxazol-2-yl)benzoate |
| SMILES | COC(=O)c1ccccc1-c1ncco1.COC(=O)c1ccccc1C(=O)Cl.COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H9NO3.C9H7ClO3.C9H8O4/c1-14-11(13)9-5-3-2-4-8(9)10-12-6-7-15-10;2*1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-7H,1H3;2-5H,1H3;2-5H,1H3,(H,10,11) |
| InChIKey | UCIAZKPJVWEFQJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 159.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|