C11H7NO4 — CID 117308845
2-[2-(1,3-oxazol-2-yl)phenyl]-2-oxoacetic acid (PubChem CID 117308845) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 2-[2-(1,3-oxazol-2-yl)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-(1,3-oxazol-2-yl)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117308845 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-[2-(1,3-oxazol-2-yl)phenyl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1ccccc1-c1ncco1 |
| InChI | InChI=1S/C11H7NO4/c13-9(11(14)15)7-3-1-2-4-8(7)10-12-5-6-16-10/h1-6H,(H,14,15) |
| InChIKey | WQGFMFLWEJWHGI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|