C13H12N2O2 — CID 14321974
(E)-N-[2-(1,3-oxazol-2-yl)phenyl]but-2-enamide (PubChem CID 14321974) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is (E)-N-[2-(1,3-oxazol-2-yl)phenyl]but-2-enamide.
| Compound Name | (E)-N-[2-(1,3-oxazol-2-yl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 14321974 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (E)-N-[2-(1,3-oxazol-2-yl)phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccccc1-c1ncco1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-5-12(16)15-11-7-4-3-6-10(11)13-14-8-9-17-13/h2-9H,1H3,(H,15,16)/b5-2+ |
| InChIKey | MLGBKJIFUYMPHS-GORDUTHDSA-N |
| XLogP | 2.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|