About 2-oxalophenolate
2-oxalophenolate (PubChem CID 54690432) has the molecular formula C8H5O4-
and a molecular weight of 165.12 g/mol. Its IUPAC name is 2-oxalophenolate.
Molecular Properties
| Compound Name | 2-oxalophenolate |
| PubChem CID | 54690432 |
| Molecular Formula | C8H5O4- |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 2-oxalophenolate |
| SMILES | O=C(O)C(=O)c1ccccc1[O-] |
| InChI | InChI=1S/C8H6O4/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,9H,(H,11,12)/p-1 |
| InChIKey | QQSFIAWCKMCGNN-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxalophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxalophenolate?
The IUPAC name of 2-oxalophenolate (CID 54690432) is 2-oxalophenolate.
What is the SMILES notation for 2-oxalophenolate?
The canonical SMILES for 2-oxalophenolate is O=C(O)C(=O)c1ccccc1[O-].
What is the InChIKey of 2-oxalophenolate?
The InChIKey is QQSFIAWCKMCGNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,9H,(H,11,12)/p-1.
What are the key properties of 2-oxalophenolate?
2-oxalophenolate has a molecular weight of 165.12 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxalophenolate is sourced from PubChem (CID 54690432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).