C21H15O5- — CID 54725784
2-carboxyphenolate;1,2-diphenylethane-1,2-dione (PubChem CID 54725784) has the molecular formula C21H15O5- and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-carboxyphenolate;1,2-diphenylethane-1,2-dione.
| Compound Name | 2-carboxyphenolate;1,2-diphenylethane-1,2-dione |
|---|---|
| PubChem CID | 54725784 |
| Molecular Formula | C21H15O5- |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-carboxyphenolate;1,2-diphenylethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C14H10O2.C7H6O3/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;8-6-4-2-1-3-5(6)7(9)10/h1-10H;1-4,8H,(H,9,10)/p-1 |
| InChIKey | LBTOHLLEHBNRFH-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|