About calcium;2-carboxyphenolate;benzoate
calcium;2-carboxyphenolate;benzoate (PubChem CID 175381363) has the molecular formula C14H10CaO5
and a molecular weight of 298.31 g/mol. Its IUPAC name is calcium;2-carboxyphenolate;benzoate.
Molecular Properties
| Compound Name | calcium;2-carboxyphenolate;benzoate |
| PubChem CID | 175381363 |
| Molecular Formula | C14H10CaO5 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | calcium;2-carboxyphenolate;benzoate |
| SMILES | O=C(O)c1ccccc1[O-].O=C([O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/C7H6O3.C7H6O2.Ca/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6;/h1-4,8H,(H,9,10);1-5H,(H,8,9);/q;;+2/p-2 |
| InChIKey | XYIZPTXPGIZCRQ-UHFFFAOYSA-L |
| XLogP | 0.13 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium;2-carboxyphenolate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-carboxyphenolate;benzoate?
The IUPAC name of calcium;2-carboxyphenolate;benzoate (CID 175381363) is calcium;2-carboxyphenolate;benzoate.
What is the SMILES notation for calcium;2-carboxyphenolate;benzoate?
The canonical SMILES for calcium;2-carboxyphenolate;benzoate is O=C(O)c1ccccc1[O-].O=C([O-])c1ccccc1.[Ca+2].
What is the InChIKey of calcium;2-carboxyphenolate;benzoate?
The InChIKey is XYIZPTXPGIZCRQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O3.C7H6O2.Ca/c8-6-4-2-1-3-5(6)7(9)10;8-7(9)6-4-2-1-3-5-6;/h1-4,8H,(H,9,10);1-5H,(H,8,9);/q;;+2/p-2.
What are the key properties of calcium;2-carboxyphenolate;benzoate?
calcium;2-carboxyphenolate;benzoate has a molecular weight of 298.31 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-carboxyphenolate;benzoate is sourced from PubChem (CID 175381363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).