C8H14O — CID 161056002
methane;1-methylbicyclo[3.1.0]hexan-3-one (PubChem CID 161056002) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is methane;1-methylbicyclo[3.1.0]hexan-3-one.
| Compound Name | methane;1-methylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 161056002 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | methane;1-methylbicyclo[3.1.0]hexan-3-one |
| SMILES | C.CC12CC(=O)CC1C2 |
| InChI | InChI=1S/C7H10O.CH4/c1-7-3-5(7)2-6(8)4-7;/h5H,2-4H2,1H3;1H4 |
| InChIKey | UCTIRSQSBGHRGI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |