C21H32OS2 — CID 155808320
(1'S,3'R,7'R,10'R,12'S,16'S)-7',16'-dimethylspiro[1,3-dithiolane-2,5'-tetracyclo[8.7.0.03,7.012,16]heptadecane]-14'-one (PubChem CID 155808320) has the molecular formula C21H32OS2 and a molecular weight of 364.62 g/mol. Its IUPAC name is (1'S,3'R,7'R,10'R,12'S,16'S)-7',16'-dimethylspiro[1,3-dithiolane-2,5'-tetracyclo[8.7.0.03,7.012,16]heptadecane]-14'-one.
| Compound Name | (1'S,3'R,7'R,10'R,12'S,16'S)-7',16'-dimethylspiro[1,3-dithiolane-2,5'-tetracyclo[8.7.0.03,7.012,16]heptadecane]-14'-one |
|---|---|
| PubChem CID | 155808320 |
| Molecular Formula | C21H32OS2 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1'S,3'R,7'R,10'R,12'S,16'S)-7',16'-dimethylspiro[1,3-dithiolane-2,5'-tetracyclo[8.7.0.03,7.012,16]heptadecane]-14'-one |
| SMILES | C[C@]12CC(=O)C[C@@H]1C[C@H]1CC[C@]3(C)CC4(C[C@H]3C[C@H]1C2)SCCS4 |
| InChI | InChI=1S/C21H32OS2/c1-19-4-3-14-7-16-9-18(22)12-20(16,2)10-15(14)8-17(19)11-21(13-19)23-5-6-24-21/h14-17H,3-13H2,1-2H3/t14-,15+,16+,17-,19-,20+/m1/s1 |
| InChIKey | UOGDBGBQCIZQBX-KWVJBRQOSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |