C58H43N4O2P — CID 161056830
7-(2-nitrophenyl)-1-phenylindole;1-phenyl-6H-pyrrolo[3,2-c]carbazole;triphenylphosphane (PubChem CID 161056830) has the molecular formula C58H43N4O2P and a molecular weight of 858.98 g/mol. Its IUPAC name is 7-(2-nitrophenyl)-1-phenylindole;1-phenyl-6H-pyrrolo[3,2-c]carbazole;triphenylphosphane.
| Compound Name | 7-(2-nitrophenyl)-1-phenylindole;1-phenyl-6H-pyrrolo[3,2-c]carbazole;triphenylphosphane |
|---|---|
| PubChem CID | 161056830 |
| Molecular Formula | C58H43N4O2P |
| Molecular Weight | 858.98 g/mol |
| Exact Mass | 858.31 |
| IUPAC Name | 7-(2-nitrophenyl)-1-phenylindole;1-phenyl-6H-pyrrolo[3,2-c]carbazole;triphenylphosphane |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2ccn(-c3ccccc3)c12.c1ccc(-n2ccc3ccc4[nH]c5ccccc5c4c32)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N2O2.C20H14N2.C18H15P/c23-22(24)19-12-5-4-10-17(19)18-11-6-7-15-13-14-21(20(15)18)16-8-2-1-3-9-16;1-2-6-15(7-3-1)22-13-12-14-10-11-18-19(20(14)22)16-8-4-5-9-17(16)21-18;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-14H;1-13,21H;1-15H |
| InChIKey | UCWCVKIIWVFVOY-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.98 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|