C29H29FN2O3 — CID 161057927
4-fluoro-2-[3-[[2-(4-methylphenyl)acetyl]amino]-4-[2-methylpropyl(prop-2-ynyl)amino]phenyl]benzoic acid (PubChem CID 161057927) has the molecular formula C29H29FN2O3 and a molecular weight of 472.56 g/mol. Its IUPAC name is 4-fluoro-2-[3-[[2-(4-methylphenyl)acetyl]amino]-4-[2-methylpropyl(prop-2-ynyl)amino]phenyl]benzoic acid.
| Compound Name | 4-fluoro-2-[3-[[2-(4-methylphenyl)acetyl]amino]-4-[2-methylpropyl(prop-2-ynyl)amino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 161057927 |
| Molecular Formula | C29H29FN2O3 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-fluoro-2-[3-[[2-(4-methylphenyl)acetyl]amino]-4-[2-methylpropyl(prop-2-ynyl)amino]phenyl]benzoic acid |
| SMILES | C#CCN(CC(C)C)c1ccc(-c2cc(F)ccc2C(=O)O)cc1NC(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C29H29FN2O3/c1-5-14-32(18-19(2)3)27-13-10-22(25-17-23(30)11-12-24(25)29(34)35)16-26(27)31-28(33)15-21-8-6-20(4)7-9-21/h1,6-13,16-17,19H,14-15,18H2,2-4H3,(H,31,33)(H,34,35) |
| InChIKey | UCZQWAMIPGWCPD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|