C29H36N2O — CID 174963232
N-[3-[2-[bis(2-methylpropyl)amino]phenyl]phenyl]-2-(4-methylphenyl)acetamide (PubChem CID 174963232) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[3-[2-[bis(2-methylpropyl)amino]phenyl]phenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[3-[2-[bis(2-methylpropyl)amino]phenyl]phenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 174963232 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | N-[3-[2-[bis(2-methylpropyl)amino]phenyl]phenyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2cccc(-c3ccccc3N(CC(C)C)CC(C)C)c2)cc1 |
| InChI | InChI=1S/C29H36N2O/c1-21(2)19-31(20-22(3)4)28-12-7-6-11-27(28)25-9-8-10-26(18-25)30-29(32)17-24-15-13-23(5)14-16-24/h6-16,18,21-22H,17,19-20H2,1-5H3,(H,30,32) |
| InChIKey | HWMUWXXYJXWLOY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |