C35H38F2N10O7 — CID 161059602
N-[4-(1,1-difluoroethoxy)phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 161059602) has the molecular formula C35H38F2N10O7 and a molecular weight of 748.75 g/mol. Its IUPAC name is N-[4-(1,1-difluoroethoxy)phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | N-[4-(1,1-difluoroethoxy)phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 161059602 |
| Molecular Formula | C35H38F2N10O7 |
| Molecular Weight | 748.75 g/mol |
| Exact Mass | 748.29 |
| IUPAC Name | N-[4-(1,1-difluoroethoxy)phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1.Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc(OC(C)(F)F)cc2)n(C)c1=O |
| InChI | InChI=1S/C18H21N5O3.C17H17F2N5O4/c1-11(2)12-5-7-13(8-6-12)20-14(24)9-23-10-19-16-15(23)17(25)22(4)18(26)21(16)3;1-17(18,19)28-11-6-4-10(5-7-11)21-12(25)8-24-9-20-14-13(24)15(26)23(3)16(27)22(14)2/h5-8,10-11H,9H2,1-4H3,(H,20,24);4-7,9H,8H2,1-3H3,(H,21,25) |
| InChIKey | UDFLOGMSLZYLKC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 191.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |