C26H25FN7O7S+ — CID 161061795
1-(3-amino-1,2-benzoxazol-5-yl)-7-fluoro-6-[1-hydroxy-5-(2-oxopiperidin-1-yl)pyridin-1-ium-2-yl]indazole-3-carboxamide;methanesulfonic acid (PubChem CID 161061795) has the molecular formula C26H25FN7O7S+ and a molecular weight of 598.59 g/mol. Its IUPAC name is 1-(3-amino-1,2-benzoxazol-5-yl)-7-fluoro-6-[1-hydroxy-5-(2-oxopiperidin-1-yl)pyridin-1-ium-2-yl]indazole-3-carboxamide;methanesulfonic acid.
| Compound Name | 1-(3-amino-1,2-benzoxazol-5-yl)-7-fluoro-6-[1-hydroxy-5-(2-oxopiperidin-1-yl)pyridin-1-ium-2-yl]indazole-3-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 161061795 |
| Molecular Formula | C26H25FN7O7S+ |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 1-(3-amino-1,2-benzoxazol-5-yl)-7-fluoro-6-[1-hydroxy-5-(2-oxopiperidin-1-yl)pyridin-1-ium-2-yl]indazole-3-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)c1nn(-c2ccc3onc(N)c3c2)c2c(F)c(-c3ccc(N4CCCCC4=O)c[n+]3O)ccc12 |
| InChI | InChI=1S/C25H20FN7O4.CH4O3S/c26-21-15(18-8-4-14(12-32(18)36)31-10-2-1-3-20(31)34)6-7-16-22(25(28)35)29-33(23(16)21)13-5-9-19-17(11-13)24(27)30-37-19;1-5(2,3)4/h4-9,11-12H,1-3,10H2,(H4-,27,28,29,30,35,36);1H3,(H,2,3,4)/p+1 |
| InChIKey | NONBEZIEYHFCBM-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 211.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|