C21H24FNO2 — CID 161062164
ethyl (3S,4R)-1,4-dibenzyl-3-fluoropyrrolidine-3-carboxylate (PubChem CID 161062164) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is ethyl (3S,4R)-1,4-dibenzyl-3-fluoropyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4R)-1,4-dibenzyl-3-fluoropyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 161062164 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | ethyl (3S,4R)-1,4-dibenzyl-3-fluoropyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(F)CN(Cc2ccccc2)C[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H24FNO2/c1-2-25-20(24)21(22)16-23(14-18-11-7-4-8-12-18)15-19(21)13-17-9-5-3-6-10-17/h3-12,19H,2,13-16H2,1H3/t19-,21-/m1/s1 |
| InChIKey | UDNRWTINWVWEED-TZIWHRDSSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |