About methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate
methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate (PubChem CID 161062378) has the molecular formula C18H14Br2N2O4S
and a molecular weight of 514.20 g/mol. Its IUPAC name is methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate.
Molecular Properties
| Compound Name | methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate |
| PubChem CID | 161062378 |
| Molecular Formula | C18H14Br2N2O4S |
| Molecular Weight | 514.20 g/mol |
| Exact Mass | 511.90 |
| IUPAC Name | methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate |
| SMILES | COC(=O)c1cc(C#N)ccc1Br.COC(=O)c1cc(C(N)=S)ccc1Br |
| InChI | InChI=1S/C9H8BrNO2S.C9H6BrNO2/c1-13-9(12)6-4-5(8(11)14)2-3-7(6)10;1-13-9(12)7-4-6(5-11)2-3-8(7)10/h2-4H,1H3,(H2,11,14);2-4H,1H3 |
| InChIKey | UDOIJHRMYCBERF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate?
The IUPAC name of methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate (CID 161062378) is methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate.
What is the SMILES notation for methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate?
The canonical SMILES for methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate is COC(=O)c1cc(C#N)ccc1Br.COC(=O)c1cc(C(N)=S)ccc1Br.
What is the InChIKey of methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate?
The InChIKey is UDOIJHRMYCBERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2S.C9H6BrNO2/c1-13-9(12)6-4-5(8(11)14)2-3-7(6)10;1-13-9(12)7-4-6(5-11)2-3-8(7)10/h2-4H,1H3,(H2,11,14);2-4H,1H3.
What are the key properties of methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate?
methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate has a molecular weight of 514.20 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5-carbamothioylbenzoate;methyl 2-bromo-5-cyanobenzoate is sourced from PubChem (CID 161062378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).