About 5-ethyl-2-methyl-1,4-dioxocane
5-ethyl-2-methyl-1,4-dioxocane (PubChem CID 161066781) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1,4-dioxocane.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-1,4-dioxocane |
| PubChem CID | 161066781 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 5-ethyl-2-methyl-1,4-dioxocane |
| SMILES | CCC1CCCOC(C)CO1 |
| InChI | InChI=1S/C9H18O2/c1-3-9-5-4-6-10-8(2)7-11-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | UECYNQZWSAMQOZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2-methyl-1,4-dioxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-1,4-dioxocane?
The IUPAC name of 5-ethyl-2-methyl-1,4-dioxocane (CID 161066781) is 5-ethyl-2-methyl-1,4-dioxocane.
What is the SMILES notation for 5-ethyl-2-methyl-1,4-dioxocane?
The canonical SMILES for 5-ethyl-2-methyl-1,4-dioxocane is CCC1CCCOC(C)CO1.
What is the InChIKey of 5-ethyl-2-methyl-1,4-dioxocane?
The InChIKey is UECYNQZWSAMQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-3-9-5-4-6-10-8(2)7-11-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-1,4-dioxocane?
5-ethyl-2-methyl-1,4-dioxocane has a molecular weight of 158.24 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-1,4-dioxocane is sourced from PubChem (CID 161066781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).