C16H32O2 — CID 165124837
2-ethyl-5,5-dimethyloxane;2-ethyloxane (PubChem CID 165124837) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-ethyl-5,5-dimethyloxane;2-ethyloxane.
| Compound Name | 2-ethyl-5,5-dimethyloxane;2-ethyloxane |
|---|---|
| PubChem CID | 165124837 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 2-ethyl-5,5-dimethyloxane;2-ethyloxane |
| SMILES | CCC1CCC(C)(C)CO1.CCC1CCCCO1 |
| InChI | InChI=1S/C9H18O.C7H14O/c1-4-8-5-6-9(2,3)7-10-8;1-2-7-5-3-4-6-8-7/h8H,4-7H2,1-3H3;7H,2-6H2,1H3 |
| InChIKey | PDOYFGWCFSQWDN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |