About ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol
ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol (PubChem CID 171644009) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol |
| PubChem CID | 171644009 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol |
| SMILES | CC.CC(C)C(C)C1(O)CCC1.CCC1CCCCO1 |
| InChI | InChI=1S/C9H18O.C7H14O.C2H6/c1-7(2)8(3)9(10)5-4-6-9;1-2-7-5-3-4-6-8-7;1-2/h7-8,10H,4-6H2,1-3H3;7H,2-6H2,1H3;1-2H3 |
| InChIKey | HNYMSVRYPDRSSI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol?
The IUPAC name of ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol (CID 171644009) is ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol.
What is the SMILES notation for ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol?
The canonical SMILES for ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol is CC.CC(C)C(C)C1(O)CCC1.CCC1CCCCO1.
What is the InChIKey of ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol?
The InChIKey is HNYMSVRYPDRSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C7H14O.C2H6/c1-7(2)8(3)9(10)5-4-6-9;1-2-7-5-3-4-6-8-7;1-2/h7-8,10H,4-6H2,1-3H3;7H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol?
ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol has a molecular weight of 286.50 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyloxane;1-(3-methylbutan-2-yl)cyclobutan-1-ol is sourced from PubChem (CID 171644009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).