C10H11BN3O2S — CID 161067941
CID 161067941 (PubChem CID 161067941) has the molecular formula C10H11BN3O2S and a molecular weight of 248.10 g/mol.
| Compound Name | CID 161067941 |
|---|---|
| PubChem CID | 161067941 |
| Molecular Formula | C10H11BN3O2S |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | — |
| SMILES | Cc1nc2ccccc2nc1NS(C)(=O)=O.[B] |
| InChI | InChI=1S/C10H11N3O2S.B/c1-7-10(13-16(2,14)15)12-9-6-4-3-5-8(9)11-7;/h3-6H,1-2H3,(H,12,13); |
| InChIKey | NISIIBYOOFVSLT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|