About 6-tert-butyl-1H-indene;6-tert-butylquinoxaline
6-tert-butyl-1H-indene;6-tert-butylquinoxaline (PubChem CID 161072666) has the molecular formula C25H30N2
and a molecular weight of 358.53 g/mol. Its IUPAC name is 6-tert-butyl-1H-indene;6-tert-butylquinoxaline.
Molecular Properties
| Compound Name | 6-tert-butyl-1H-indene;6-tert-butylquinoxaline |
| PubChem CID | 161072666 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-tert-butyl-1H-indene;6-tert-butylquinoxaline |
| SMILES | CC(C)(C)c1ccc2c(c1)CC=C2.CC(C)(C)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C13H16.C12H14N2/c1-13(2,3)12-8-7-10-5-4-6-11(10)9-12;1-12(2,3)9-4-5-10-11(8-9)14-7-6-13-10/h4-5,7-9H,6H2,1-3H3;4-8H,1-3H3 |
| InChIKey | UEWBDVJTRJVIQE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-1H-indene;6-tert-butylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-1H-indene;6-tert-butylquinoxaline?
The IUPAC name of 6-tert-butyl-1H-indene;6-tert-butylquinoxaline (CID 161072666) is 6-tert-butyl-1H-indene;6-tert-butylquinoxaline.
What is the SMILES notation for 6-tert-butyl-1H-indene;6-tert-butylquinoxaline?
The canonical SMILES for 6-tert-butyl-1H-indene;6-tert-butylquinoxaline is CC(C)(C)c1ccc2c(c1)CC=C2.CC(C)(C)c1ccc2nccnc2c1.
What is the InChIKey of 6-tert-butyl-1H-indene;6-tert-butylquinoxaline?
The InChIKey is UEWBDVJTRJVIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16.C12H14N2/c1-13(2,3)12-8-7-10-5-4-6-11(10)9-12;1-12(2,3)9-4-5-10-11(8-9)14-7-6-13-10/h4-5,7-9H,6H2,1-3H3;4-8H,1-3H3.
What are the key properties of 6-tert-butyl-1H-indene;6-tert-butylquinoxaline?
6-tert-butyl-1H-indene;6-tert-butylquinoxaline has a molecular weight of 358.53 g/mol, XLogP of 6.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-1H-indene;6-tert-butylquinoxaline is sourced from PubChem (CID 161072666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).