About (4-dec-1-ynylphenyl)phosphonic acid;methane
(4-dec-1-ynylphenyl)phosphonic acid;methane (PubChem CID 161073886) has the molecular formula C17H27O3P
and a molecular weight of 310.37 g/mol. Its IUPAC name is (4-dec-1-ynylphenyl)phosphonic acid;methane.
Molecular Properties
| Compound Name | (4-dec-1-ynylphenyl)phosphonic acid;methane |
| PubChem CID | 161073886 |
| Molecular Formula | C17H27O3P |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4-dec-1-ynylphenyl)phosphonic acid;methane |
| SMILES | C.CCCCCCCCC#Cc1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C16H23O3P.CH4/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19;/h11-14H,2-8H2,1H3,(H2,17,18,19);1H4 |
| InChIKey | UEZWZTDAXIJTHG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-dec-1-ynylphenyl)phosphonic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-dec-1-ynylphenyl)phosphonic acid;methane?
The IUPAC name of (4-dec-1-ynylphenyl)phosphonic acid;methane (CID 161073886) is (4-dec-1-ynylphenyl)phosphonic acid;methane.
What is the SMILES notation for (4-dec-1-ynylphenyl)phosphonic acid;methane?
The canonical SMILES for (4-dec-1-ynylphenyl)phosphonic acid;methane is C.CCCCCCCCC#Cc1ccc(P(=O)(O)O)cc1.
What is the InChIKey of (4-dec-1-ynylphenyl)phosphonic acid;methane?
The InChIKey is UEZWZTDAXIJTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23O3P.CH4/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19;/h11-14H,2-8H2,1H3,(H2,17,18,19);1H4.
What are the key properties of (4-dec-1-ynylphenyl)phosphonic acid;methane?
(4-dec-1-ynylphenyl)phosphonic acid;methane has a molecular weight of 310.37 g/mol, XLogP of 4.23, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-dec-1-ynylphenyl)phosphonic acid;methane is sourced from PubChem (CID 161073886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).