C16H30O — CID 161074213
(1R)-1-cyclopentyl-2-(2,3,4,5-tetramethylcyclopentyl)ethanol (PubChem CID 161074213) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-2-(2,3,4,5-tetramethylcyclopentyl)ethanol.
| Compound Name | (1R)-1-cyclopentyl-2-(2,3,4,5-tetramethylcyclopentyl)ethanol |
|---|---|
| PubChem CID | 161074213 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (1R)-1-cyclopentyl-2-(2,3,4,5-tetramethylcyclopentyl)ethanol |
| SMILES | CC1C(C)C(C)C(C[C@@H](O)C2CCCC2)C1C |
| InChI | InChI=1S/C16H30O/c1-10-11(2)13(4)15(12(10)3)9-16(17)14-7-5-6-8-14/h10-17H,5-9H2,1-4H3/t10?,11?,12?,13?,15?,16-/m1/s1 |
| InChIKey | UFAYCUCGDQUFDW-YURKZOEYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |