C95H91B3F6N18O21S3 — CID 161079528
CID 161079528 (PubChem CID 161079528) has the molecular formula C95H91B3F6N18O21S3 and a molecular weight of 2063.50 g/mol.
| Compound Name | CID 161079528 |
|---|---|
| PubChem CID | 161079528 |
| Molecular Formula | C95H91B3F6N18O21S3 |
| Molecular Weight | 2063.50 g/mol |
| Exact Mass | 2062.60 |
| IUPAC Name | — |
| SMILES | [B]C(=O)[C@H](Cc1ccc(-n2c(=O)c(C)cn(C)c2=O)nc1)NC(=O)c1cc(F)c(NS(=O)(=O)c2ccc(NC(=O)C(C)(C)C)cc2)cc1F.[B]C(=O)[C@H](Cc1ccc(-n2c(=O)cc(C)n(C)c2=O)nc1)NC(=O)c1cc(F)c(NS(=O)(=O)c2ccc(NC(=O)C(C)(C)C)cc2)cc1F.[B]C(=O)[C@H](Cc1ccc(-n2c(=O)ccn(C)c2=O)nc1)NC(=O)c1cc(F)c(NS(=O)(=O)c2ccc(NC(=O)C(C)(C)C)cc2)cc1F |
| InChI | InChI=1S/2C32H31BF2N6O7S.C31H29BF2N6O7S/c1-17-16-40(5)31(46)41(29(17)44)26-11-6-18(15-36-26)12-25(27(33)42)38-28(43)21-13-23(35)24(14-22(21)34)39-49(47,48)20-9-7-19(8-10-20)37-30(45)32(2,3)4;1-17-12-27(42)41(31(46)40(17)5)26-11-6-18(16-36-26)13-25(28(33)43)38-29(44)21-14-23(35)24(15-22(21)34)39-49(47,48)20-9-7-19(8-10-20)37-30(45)32(2,3)4;1-31(2,3)29(44)36-18-6-8-19(9-7-18)48(46,47)38-23-15-21(33)20(14-22(23)34)28(43)37-24(27(32)42)13-17-5-10-25(35-16-17)40-26(41)11-12-39(4)30(40)45/h6-11,13-16,25,39H,12H2,1-5H3,(H,37,45)(H,38,43);6-12,14-16,25,39H,13H2,1-5H3,(H,37,45)(H,38,44);5-12,14-16,24,38H,13H2,1-4H3,(H,36,44)(H,37,43)/t2*25-;24-/m000/s1 |
| InChIKey | QPWRIOYRWFMOTE-BFWMNUGYSA-N |
| XLogP | 6.71 |
| TPSA | 534.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 146 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2063.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|