C33H33BF2N6O7S — CID 174036607
CID 174036607 (PubChem CID 174036607) has the molecular formula C33H33BF2N6O7S and a molecular weight of 706.54 g/mol.
| Compound Name | CID 174036607 |
|---|---|
| PubChem CID | 174036607 |
| Molecular Formula | C33H33BF2N6O7S |
| Molecular Weight | 706.54 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | — |
| SMILES | [B]C(=O)[C@H](CCc1ccc(-n2c(=O)c(C)cn(C)c2=O)nc1)NC(=O)c1cc(F)c(NS(=O)(=O)c2ccc(C(=O)NC(C)(C)C)cc2)cc1F |
| InChI | InChI=1S/C33H33BF2N6O7S/c1-18-17-41(5)32(47)42(31(18)46)27-13-7-19(16-37-27)6-12-25(28(34)43)38-30(45)22-14-24(36)26(15-23(22)35)40-50(48,49)21-10-8-20(9-11-21)29(44)39-33(2,3)4/h7-11,13-17,25,40H,6,12H2,1-5H3,(H,38,45)(H,39,44)/t25-/m0/s1 |
| InChIKey | CYMQDHGIRFYPEC-VWLOTQADSA-N |
| XLogP | 2.27 |
| TPSA | 178.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|