About 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene
1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene (PubChem CID 161082404) has the molecular formula C13H8F4I2
and a molecular weight of 494.01 g/mol. Its IUPAC name is 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene |
| PubChem CID | 161082404 |
| Molecular Formula | C13H8F4I2 |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.87 |
| IUPAC Name | 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(I)c1.Fc1cccc(I)c1 |
| InChI | InChI=1S/C7H4F3I.C6H4FI/c8-7(9,10)5-2-1-3-6(11)4-5;7-5-2-1-3-6(8)4-5/h1-4H;1-4H |
| InChIKey | UGBRSDYPHYOCDV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene?
The IUPAC name of 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene (CID 161082404) is 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene.
What is the SMILES notation for 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene?
The canonical SMILES for 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene is FC(F)(F)c1cccc(I)c1.Fc1cccc(I)c1.
What is the InChIKey of 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene?
The InChIKey is UGBRSDYPHYOCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3I.C6H4FI/c8-7(9,10)5-2-1-3-6(11)4-5;7-5-2-1-3-6(8)4-5/h1-4H;1-4H.
What are the key properties of 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene?
1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene has a molecular weight of 494.01 g/mol, XLogP of 5.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-iodobenzene;1-iodo-3-(trifluoromethyl)benzene is sourced from PubChem (CID 161082404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).