C28H16F8I2O — CID 22336558
1-iodo-3-[1,1,2,2-tetrafluoro-2-[4-[4-[1,1,2,2-tetrafluoro-2-(3-iodophenyl)ethyl]phenoxy]phenyl]ethyl]benzene (PubChem CID 22336558) has the molecular formula C28H16F8I2O and a molecular weight of 774.23 g/mol. Its IUPAC name is 1-iodo-3-[1,1,2,2-tetrafluoro-2-[4-[4-[1,1,2,2-tetrafluoro-2-(3-iodophenyl)ethyl]phenoxy]phenyl]ethyl]benzene.
| Compound Name | 1-iodo-3-[1,1,2,2-tetrafluoro-2-[4-[4-[1,1,2,2-tetrafluoro-2-(3-iodophenyl)ethyl]phenoxy]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 22336558 |
| Molecular Formula | C28H16F8I2O |
| Molecular Weight | 774.23 g/mol |
| Exact Mass | 773.92 |
| IUPAC Name | 1-iodo-3-[1,1,2,2-tetrafluoro-2-[4-[4-[1,1,2,2-tetrafluoro-2-(3-iodophenyl)ethyl]phenoxy]phenyl]ethyl]benzene |
| SMILES | FC(F)(c1ccc(Oc2ccc(C(F)(F)C(F)(F)c3cccc(I)c3)cc2)cc1)C(F)(F)c1cccc(I)c1 |
| InChI | InChI=1S/C28H16F8I2O/c29-25(30,27(33,34)19-3-1-5-21(37)15-19)17-7-11-23(12-8-17)39-24-13-9-18(10-14-24)26(31,32)28(35,36)20-4-2-6-22(38)16-20/h1-16H |
| InChIKey | RFODRVLREIUQJS-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.23 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|