C11H9F6IO2 — CID 141209545
1-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-3-iodobenzene (PubChem CID 141209545) has the molecular formula C11H9F6IO2 and a molecular weight of 414.08 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-3-iodobenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-3-iodobenzene |
|---|---|
| PubChem CID | 141209545 |
| Molecular Formula | C11H9F6IO2 |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-3-iodobenzene |
| SMILES | COCOC(c1cccc(I)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F6IO2/c1-19-6-20-9(10(12,13)14,11(15,16)17)7-3-2-4-8(18)5-7/h2-5H,6H2,1H3 |
| InChIKey | PJRRTVCJRIVKOC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|