C19H26F6N2O2 — CID 87070835
1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenyl]-1,4-diazepane (PubChem CID 87070835) has the molecular formula C19H26F6N2O2 and a molecular weight of 428.42 g/mol. Its IUPAC name is 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenyl]-1,4-diazepane.
| Compound Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenyl]-1,4-diazepane |
|---|---|
| PubChem CID | 87070835 |
| Molecular Formula | C19H26F6N2O2 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenyl]-1,4-diazepane |
| SMILES | CCCc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1N1CCCNCC1 |
| InChI | InChI=1S/C19H26F6N2O2/c1-3-5-14-12-15(6-7-16(14)27-10-4-8-26-9-11-27)17(18(20,21)22,19(23,24)25)29-13-28-2/h6-7,12,26H,3-5,8-11,13H2,1-2H3 |
| InChIKey | MOUKZDMAGFAWEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|