C15H14BrF3O4 — CID 161085635
6-bromo-8-ethoxy-2-ethyl-2-(trifluoromethyl)chromene-3-carboxylic acid (PubChem CID 161085635) has the molecular formula C15H14BrF3O4 and a molecular weight of 395.17 g/mol. Its IUPAC name is 6-bromo-8-ethoxy-2-ethyl-2-(trifluoromethyl)chromene-3-carboxylic acid.
| Compound Name | 6-bromo-8-ethoxy-2-ethyl-2-(trifluoromethyl)chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 161085635 |
| Molecular Formula | C15H14BrF3O4 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 6-bromo-8-ethoxy-2-ethyl-2-(trifluoromethyl)chromene-3-carboxylic acid |
| SMILES | CCOc1cc(Br)cc2c1OC(CC)(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C15H14BrF3O4/c1-3-14(15(17,18)19)10(13(20)21)6-8-5-9(16)7-11(22-4-2)12(8)23-14/h5-7H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | UGLXCKKZZUNJNH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |