C8H9F6NO — CID 161088452
3-(1,1-difluoropentoxy)-2,2,3,3-tetrafluoropropanenitrile (PubChem CID 161088452) has the molecular formula C8H9F6NO and a molecular weight of 249.15 g/mol. Its IUPAC name is 3-(1,1-difluoropentoxy)-2,2,3,3-tetrafluoropropanenitrile.
| Compound Name | 3-(1,1-difluoropentoxy)-2,2,3,3-tetrafluoropropanenitrile |
|---|---|
| PubChem CID | 161088452 |
| Molecular Formula | C8H9F6NO |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(1,1-difluoropentoxy)-2,2,3,3-tetrafluoropropanenitrile |
| SMILES | CCCCC(F)(F)OC(F)(F)C(F)(F)C#N |
| InChI | InChI=1S/C8H9F6NO/c1-2-3-4-7(11,12)16-8(13,14)6(9,10)5-15/h2-4H2,1H3 |
| InChIKey | UGVOPTSXDULLRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|