C16H22N4 — CID 88846112
dodecane-5,5,6,6-tetracarbonitrile (PubChem CID 88846112) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is dodecane-5,5,6,6-tetracarbonitrile.
| Compound Name | dodecane-5,5,6,6-tetracarbonitrile |
|---|---|
| PubChem CID | 88846112 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | dodecane-5,5,6,6-tetracarbonitrile |
| SMILES | CCCCCC(C#N)(C#N)C(C#N)(C#N)CCCCC |
| InChI | InChI=1S/C16H22N4/c1-3-5-7-9-15(11-17,12-18)16(13-19,14-20)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | FUXQDBRXGCGNCT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|