About boric acid;2-hexyl-2-methyloctanenitrile
boric acid;2-hexyl-2-methyloctanenitrile (PubChem CID 175281254) has the molecular formula C15H32BNO3
and a molecular weight of 285.24 g/mol. Its IUPAC name is boric acid;2-hexyl-2-methyloctanenitrile.
Molecular Properties
| Compound Name | boric acid;2-hexyl-2-methyloctanenitrile |
| PubChem CID | 175281254 |
| Molecular Formula | C15H32BNO3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | boric acid;2-hexyl-2-methyloctanenitrile |
| SMILES | CCCCCCC(C)(C#N)CCCCCC.OB(O)O |
| InChI | InChI=1S/C15H29N.BH3O3/c1-4-6-8-10-12-15(3,14-16)13-11-9-7-5-2;2-1(3)4/h4-13H2,1-3H3;2-4H |
| InChIKey | PTLHUEASRXMFST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2-hexyl-2-methyloctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2-hexyl-2-methyloctanenitrile?
The IUPAC name of boric acid;2-hexyl-2-methyloctanenitrile (CID 175281254) is boric acid;2-hexyl-2-methyloctanenitrile.
What is the SMILES notation for boric acid;2-hexyl-2-methyloctanenitrile?
The canonical SMILES for boric acid;2-hexyl-2-methyloctanenitrile is CCCCCCC(C)(C#N)CCCCCC.OB(O)O.
What is the InChIKey of boric acid;2-hexyl-2-methyloctanenitrile?
The InChIKey is PTLHUEASRXMFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N.BH3O3/c1-4-6-8-10-12-15(3,14-16)13-11-9-7-5-2;2-1(3)4/h4-13H2,1-3H3;2-4H.
What are the key properties of boric acid;2-hexyl-2-methyloctanenitrile?
boric acid;2-hexyl-2-methyloctanenitrile has a molecular weight of 285.24 g/mol, XLogP of 3.41, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2-hexyl-2-methyloctanenitrile is sourced from PubChem (CID 175281254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).