C34H45Cl2N7O5Si — CID 161090675
N-[2-[[6-[[(2,6-dichloro-3,5-dimethoxyphenyl)-(2-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]methyl]-5-piperazin-1-ylphenyl]prop-2-enamide (PubChem CID 161090675) has the molecular formula C34H45Cl2N7O5Si and a molecular weight of 730.77 g/mol. Its IUPAC name is N-[2-[[6-[[(2,6-dichloro-3,5-dimethoxyphenyl)-(2-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]methyl]-5-piperazin-1-ylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-[[(2,6-dichloro-3,5-dimethoxyphenyl)-(2-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]methyl]-5-piperazin-1-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 161090675 |
| Molecular Formula | C34H45Cl2N7O5Si |
| Molecular Weight | 730.77 g/mol |
| Exact Mass | 729.26 |
| IUPAC Name | N-[2-[[6-[[(2,6-dichloro-3,5-dimethoxyphenyl)-(2-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]methyl]-5-piperazin-1-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCNCC2)ccc1Cc1cc(N(C)C(=O)N(COCC[Si](C)(C)C)c2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C34H45Cl2N7O5Si/c1-8-30(44)40-26-19-25(42-13-11-37-12-14-42)10-9-23(26)17-24-18-29(39-21-38-24)41(2)34(45)43(22-48-15-16-49(5,6)7)33-31(35)27(46-3)20-28(47-4)32(33)36/h8-10,18-21,37H,1,11-17,22H2,2-7H3,(H,40,44) |
| InChIKey | MJYRIMFSYCVXSW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|