C30H42Cl2N6O4Si — CID 157099163
1-[6-[[2-amino-4-[(dimethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-(2-trimethylsilylethoxymethyl)urea (PubChem CID 157099163) has the molecular formula C30H42Cl2N6O4Si and a molecular weight of 649.70 g/mol. Its IUPAC name is 1-[6-[[2-amino-4-[(dimethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-(2-trimethylsilylethoxymethyl)urea.
| Compound Name | 1-[6-[[2-amino-4-[(dimethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-(2-trimethylsilylethoxymethyl)urea |
|---|---|
| PubChem CID | 157099163 |
| Molecular Formula | C30H42Cl2N6O4Si |
| Molecular Weight | 649.70 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | 1-[6-[[2-amino-4-[(dimethylamino)methyl]phenyl]methyl]pyrimidin-4-yl]-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-methyl-3-(2-trimethylsilylethoxymethyl)urea |
| SMILES | COc1cc(OC)c(Cl)c(N(COCC[Si](C)(C)C)C(=O)N(C)c2cc(Cc3ccc(CN(C)C)cc3N)ncn2)c1Cl |
| InChI | InChI=1S/C30H42Cl2N6O4Si/c1-36(2)17-20-9-10-21(23(33)13-20)14-22-15-26(35-18-34-22)37(3)30(39)38(19-42-11-12-43(6,7)8)29-27(31)24(40-4)16-25(41-5)28(29)32/h9-10,13,15-16,18H,11-12,14,17,19,33H2,1-8H3 |
| InChIKey | HKBHVILTNGMSAE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.70 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|