C31H42Cl2N6O6Si — CID 154589801
tert-butyl N-(2-aminophenyl)-N-[6-[[(2,4-dichloro-3,5-dimethoxyphenyl)-(1-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]carbamate (PubChem CID 154589801) has the molecular formula C31H42Cl2N6O6Si and a molecular weight of 693.71 g/mol. Its IUPAC name is tert-butyl N-(2-aminophenyl)-N-[6-[[(2,4-dichloro-3,5-dimethoxyphenyl)-(1-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-(2-aminophenyl)-N-[6-[[(2,4-dichloro-3,5-dimethoxyphenyl)-(1-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 154589801 |
| Molecular Formula | C31H42Cl2N6O6Si |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | tert-butyl N-(2-aminophenyl)-N-[6-[[(2,4-dichloro-3,5-dimethoxyphenyl)-(1-trimethylsilylethoxymethyl)carbamoyl]-methylamino]pyrimidin-4-yl]carbamate |
| SMILES | COc1cc(N(COC(C)[Si](C)(C)C)C(=O)N(C)c2cc(N(C(=O)OC(C)(C)C)c3ccccc3N)ncn2)c(Cl)c(OC)c1Cl |
| InChI | InChI=1S/C31H42Cl2N6O6Si/c1-19(46(8,9)10)44-18-38(22-15-23(42-6)27(33)28(43-7)26(22)32)29(40)37(5)24-16-25(36-17-35-24)39(30(41)45-31(2,3)4)21-14-12-11-13-20(21)34/h11-17,19H,18,34H2,1-10H3 |
| InChIKey | BIAUDBFUDRVWOP-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|