C28H30Cl2N4O5 — CID 145168761
tert-butyl N-[5-[(2,6-dichloro-3,5-dimethoxyanilino)methyl]-2-pyridinyl]-N-[2-(prop-2-enoylamino)phenyl]carbamate (PubChem CID 145168761) has the molecular formula C28H30Cl2N4O5 and a molecular weight of 573.48 g/mol. Its IUPAC name is tert-butyl N-[5-[(2,6-dichloro-3,5-dimethoxyanilino)methyl]-2-pyridinyl]-N-[2-(prop-2-enoylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2,6-dichloro-3,5-dimethoxyanilino)methyl]-2-pyridinyl]-N-[2-(prop-2-enoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 145168761 |
| Molecular Formula | C28H30Cl2N4O5 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | tert-butyl N-[5-[(2,6-dichloro-3,5-dimethoxyanilino)methyl]-2-pyridinyl]-N-[2-(prop-2-enoylamino)phenyl]carbamate |
| SMILES | C=CC(=O)Nc1ccccc1N(C(=O)OC(C)(C)C)c1ccc(CNc2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C28H30Cl2N4O5/c1-7-23(35)33-18-10-8-9-11-19(18)34(27(36)39-28(2,3)4)22-13-12-17(15-31-22)16-32-26-24(29)20(37-5)14-21(38-6)25(26)30/h7-15,32H,1,16H2,2-6H3,(H,33,35) |
| InChIKey | QKJGWXBJOYIPMK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|