C20H29Cl2N3O5Si — CID 154019590
1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-(2-trimethylsilylethoxymethyl)urea (PubChem CID 154019590) has the molecular formula C20H29Cl2N3O5Si and a molecular weight of 490.46 g/mol. Its IUPAC name is 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-(2-trimethylsilylethoxymethyl)urea.
| Compound Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-(2-trimethylsilylethoxymethyl)urea |
|---|---|
| PubChem CID | 154019590 |
| Molecular Formula | C20H29Cl2N3O5Si |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[(3-methyl-1,2-oxazol-5-yl)methyl]-1-(2-trimethylsilylethoxymethyl)urea |
| SMILES | COc1cc(OC)c(Cl)c(N(COCC[Si](C)(C)C)C(=O)NCc2cc(C)no2)c1Cl |
| InChI | InChI=1S/C20H29Cl2N3O5Si/c1-13-9-14(30-24-13)11-23-20(26)25(12-29-7-8-31(4,5)6)19-17(21)15(27-2)10-16(28-3)18(19)22/h9-10H,7-8,11-12H2,1-6H3,(H,23,26) |
| InChIKey | JTULWHJKIXRTEL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|